C20H24O2 — CID 11185554
ethyl 3-ethyl-2-methyl-4-(2-phenylethynyl)cyclohex-2-ene-1-carboxylate (PubChem CID 11185554) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethyl 3-ethyl-2-methyl-4-(2-phenylethynyl)cyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 3-ethyl-2-methyl-4-(2-phenylethynyl)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11185554 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | ethyl 3-ethyl-2-methyl-4-(2-phenylethynyl)cyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(C#Cc2ccccc2)C(CC)=C1C |
| InChI | InChI=1S/C20H24O2/c1-4-18-15(3)19(20(21)22-5-2)14-13-17(18)12-11-16-9-7-6-8-10-16/h6-10,17,19H,4-5,13-14H2,1-3H3 |
| InChIKey | SHNRBJJWKFIOQE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|