C24H21NO4 — CID 54057914
3-ethoxycarbonyl-2-methyl-6-phenyl-4-(2-phenylethynyl)-3,4-dihydropyridine-5-carboxylic acid (PubChem CID 54057914) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-ethoxycarbonyl-2-methyl-6-phenyl-4-(2-phenylethynyl)-3,4-dihydropyridine-5-carboxylic acid.
| Compound Name | 3-ethoxycarbonyl-2-methyl-6-phenyl-4-(2-phenylethynyl)-3,4-dihydropyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 54057914 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-ethoxycarbonyl-2-methyl-6-phenyl-4-(2-phenylethynyl)-3,4-dihydropyridine-5-carboxylic acid |
| SMILES | CCOC(=O)C1C(C)=NC(c2ccccc2)=C(C(=O)O)C1C#Cc1ccccc1 |
| InChI | InChI=1S/C24H21NO4/c1-3-29-24(28)20-16(2)25-22(18-12-8-5-9-13-18)21(23(26)27)19(20)15-14-17-10-6-4-7-11-17/h4-13,19-20H,3H2,1-2H3,(H,26,27) |
| InChIKey | LXOONHIAQDNNQR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|