C31H27NO4 — CID 10648294
3-O-benzyl 5-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10648294) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is 3-O-benzyl 5-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-benzyl 5-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10648294 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-O-benzyl 5-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC(C)=C(C(=O)OCc2ccccc2)C1C#Cc1ccccc1 |
| InChI | InChI=1S/C31H27NO4/c1-3-35-31(34)28-26(20-19-23-13-7-4-8-14-23)27(30(33)36-21-24-15-9-5-10-16-24)22(2)32-29(28)25-17-11-6-12-18-25/h4-18,26,32H,3,21H2,1-2H3 |
| InChIKey | ACIYZJUAOZWVNU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|