C30H31NO4 — CID 100918509
3-O-benzyl 5-O-ethyl (4S)-2-cyclopentyl-6-methyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 100918509) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 3-O-benzyl 5-O-ethyl (4S)-2-cyclopentyl-6-methyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-benzyl 5-O-ethyl (4S)-2-cyclopentyl-6-methyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 100918509 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 3-O-benzyl 5-O-ethyl (4S)-2-cyclopentyl-6-methyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C2CCCC2)=C(C(=O)OCc2ccccc2)[C@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C30H31NO4/c1-3-34-29(32)26-21(2)31-28(24-16-10-11-17-24)27(25(26)19-18-22-12-6-4-7-13-22)30(33)35-20-23-14-8-5-9-15-23/h4-9,12-15,24-25,31H,3,10-11,16-17,20H2,1-2H3/t25-/m0/s1 |
| InChIKey | GLFDKORLOKZWPL-VWLOTQADSA-N |
| XLogP | 5.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|