C28H29NO4 — CID 10575245
5-O-tert-butyl 3-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10575245) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10575245 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 5-O-tert-butyl 3-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(c2ccccc2)=C(C(=O)OC(C)(C)C)C1C#Cc1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c1-6-32-26(30)23-19(2)29-25(21-15-11-8-12-16-21)24(27(31)33-28(3,4)5)22(23)18-17-20-13-9-7-10-14-20/h7-16,22,29H,6H2,1-5H3 |
| InChIKey | WCYSJJRDDZPEJG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|