C19H22O3 — CID 155935899
ethyl 1-oxo-4-phenyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-2-carboxylate (PubChem CID 155935899) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl 1-oxo-4-phenyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-2-carboxylate.
| Compound Name | ethyl 1-oxo-4-phenyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 155935899 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | ethyl 1-oxo-4-phenyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1C=C(c2ccccc2)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H22O3/c1-2-22-19(21)17-12-16(13-8-4-3-5-9-13)14-10-6-7-11-15(14)18(17)20/h3-5,8-9,12,14-15,17H,2,6-7,10-11H2,1H3 |
| InChIKey | XTUKNJNGBQHZSN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|