C19H22O3 — CID 102446817
ethyl (2R,3R,4aR)-8-oxo-3-phenyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-2-carboxylate (PubChem CID 102446817) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (2R,3R,4aR)-8-oxo-3-phenyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-2-carboxylate.
| Compound Name | ethyl (2R,3R,4aR)-8-oxo-3-phenyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 102446817 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | ethyl (2R,3R,4aR)-8-oxo-3-phenyl-3,4,4a,5,6,7-hexahydro-2H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C2C(=O)CCC[C@@H]2C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-2-22-19(21)17-12-16-14(9-6-10-18(16)20)11-15(17)13-7-4-3-5-8-13/h3-5,7-8,12,14-15,17H,2,6,9-11H2,1H3/t14-,15+,17-/m1/s1 |
| InChIKey | IJBQVZASWDMKRP-HLLBOEOZSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |