C16H22O2 — CID 102301673
ethyl (3aR,4S)-2,3,3a,4,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalene-4-carboxylate (PubChem CID 102301673) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is ethyl (3aR,4S)-2,3,3a,4,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalene-4-carboxylate.
| Compound Name | ethyl (3aR,4S)-2,3,3a,4,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalene-4-carboxylate |
|---|---|
| PubChem CID | 102301673 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethyl (3aR,4S)-2,3,3a,4,6,7,8,9-octahydro-1H-cyclopenta[a]naphthalene-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=C2CCCCC2=C2CCC[C@@H]21 |
| InChI | InChI=1S/C16H22O2/c1-2-18-16(17)15-10-11-6-3-4-7-12(11)13-8-5-9-14(13)15/h10,14-15H,2-9H2,1H3/t14-,15-/m0/s1 |
| InChIKey | YAFTZXSQGHRTDG-GJZGRUSLSA-N |
| XLogP | 3.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |