C9H13NO5 — CID 71186618
2-ethoxycarbonyl-6-oxopiperidine-1-carboxylic acid (PubChem CID 71186618) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-ethoxycarbonyl-6-oxopiperidine-1-carboxylic acid.
| Compound Name | 2-ethoxycarbonyl-6-oxopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 71186618 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-ethoxycarbonyl-6-oxopiperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C1CCCC(=O)N1C(=O)O |
| InChI | InChI=1S/C9H13NO5/c1-2-15-8(12)6-4-3-5-7(11)10(6)9(13)14/h6H,2-5H2,1H3,(H,13,14) |
| InChIKey | XHYAXDIPVMAVML-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |