C14H22N2O6 — CID 175821432
ethyl 1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 175821432) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is ethyl 1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175821432 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ethyl 1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCC(=O)N1C(=O)[C@@H](NC(=O)OC)C(C)C |
| InChI | InChI=1S/C14H22N2O6/c1-5-22-13(19)9-6-7-10(17)16(9)12(18)11(8(2)3)15-14(20)21-4/h8-9,11H,5-7H2,1-4H3,(H,15,20)/t9?,11-/m0/s1 |
| InChIKey | VCMYKJTTYDGLSB-UMJHXOGRSA-N |
| XLogP | 0.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |