C24H24O3 — CID 91741060
ethyl 1-(2-oxocyclohexyl)-2,3-diphenylcycloprop-2-ene-1-carboxylate (PubChem CID 91741060) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl 1-(2-oxocyclohexyl)-2,3-diphenylcycloprop-2-ene-1-carboxylate.
| Compound Name | ethyl 1-(2-oxocyclohexyl)-2,3-diphenylcycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 91741060 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl 1-(2-oxocyclohexyl)-2,3-diphenylcycloprop-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C2CCCCC2=O)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C24H24O3/c1-2-27-23(26)24(19-15-9-10-16-20(19)25)21(17-11-5-3-6-12-17)22(24)18-13-7-4-8-14-18/h3-8,11-14,19H,2,9-10,15-16H2,1H3 |
| InChIKey | HMIPDYFTQZXNEG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|