C22H29NO5Si — CID 10093310
ethyl (1R,2R,7S,8R)-8-hydroxy-11-oxo-10-phenyl-7-trimethylsilyloxy-9-azatricyclo[6.2.1.02,7]undec-9-ene-1-carboxylate (PubChem CID 10093310) has the molecular formula C22H29NO5Si and a molecular weight of 415.56 g/mol. Its IUPAC name is ethyl (1R,2R,7S,8R)-8-hydroxy-11-oxo-10-phenyl-7-trimethylsilyloxy-9-azatricyclo[6.2.1.02,7]undec-9-ene-1-carboxylate.
| Compound Name | ethyl (1R,2R,7S,8R)-8-hydroxy-11-oxo-10-phenyl-7-trimethylsilyloxy-9-azatricyclo[6.2.1.02,7]undec-9-ene-1-carboxylate |
|---|---|
| PubChem CID | 10093310 |
| Molecular Formula | C22H29NO5Si |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | ethyl (1R,2R,7S,8R)-8-hydroxy-11-oxo-10-phenyl-7-trimethylsilyloxy-9-azatricyclo[6.2.1.02,7]undec-9-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)[C@@](O)(N=C1c1ccccc1)[C@]1(O[Si](C)(C)C)CCCC[C@H]21 |
| InChI | InChI=1S/C22H29NO5Si/c1-5-27-19(25)21-16-13-9-10-14-20(16,28-29(2,3)4)22(26,18(21)24)23-17(21)15-11-7-6-8-12-15/h6-8,11-12,16,26H,5,9-10,13-14H2,1-4H3/t16-,20-,21+,22-/m0/s1 |
| InChIKey | LPGFKUVWJNMVCD-ZIPUMODLSA-N |
| XLogP | 3.09 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|