C21H18Br2 — CID 97295750
(1S,4R,5S,8R)-4,8-dibromo-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene (PubChem CID 97295750) has the molecular formula C21H18Br2 and a molecular weight of 430.18 g/mol. Its IUPAC name is (1S,4R,5S,8R)-4,8-dibromo-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene.
| Compound Name | (1S,4R,5S,8R)-4,8-dibromo-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene |
|---|---|
| PubChem CID | 97295750 |
| Molecular Formula | C21H18Br2 |
| Molecular Weight | 430.18 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | (1S,4R,5S,8R)-4,8-dibromo-2,6-diphenylbicyclo[3.3.1]nona-2,6-diene |
| SMILES | Br[C@@H]1C=C(c2ccccc2)[C@@H]2C[C@H]1C(c1ccccc1)=C[C@H]2Br |
| InChI | InChI=1S/C21H18Br2/c22-20-12-16(14-7-3-1-4-8-14)18-11-19(20)17(13-21(18)23)15-9-5-2-6-10-15/h1-10,12-13,18-21H,11H2/t18-,19-,20+,21+/m0/s1 |
| InChIKey | GZMSWWLYOVNSKV-UWHLTILDSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.18 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|