C21H20O2 — CID 71571107
(1S,8R)-4,5-dimethoxy-10-phenyltetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene (PubChem CID 71571107) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1S,8R)-4,5-dimethoxy-10-phenyltetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene.
| Compound Name | (1S,8R)-4,5-dimethoxy-10-phenyltetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
|---|---|
| PubChem CID | 71571107 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1S,8R)-4,5-dimethoxy-10-phenyltetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
| SMILES | COc1cc2c(cc1OC)[C@@H]1C[C@H]2C2C=C(c3ccccc3)C21 |
| InChI | InChI=1S/C21H20O2/c1-22-19-10-15-14-9-18(16(15)11-20(19)23-2)21-13(8-17(14)21)12-6-4-3-5-7-12/h3-8,10-11,14,17-18,21H,9H2,1-2H3/t14-,17?,18+,21?/m1/s1 |
| InChIKey | ACHXNMQIFVDIJM-KWGJUECJSA-N |
| XLogP | 4.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |