C15H13BrO — CID 150262153
2-bromo-5-phenyl-2,3,3a,4-tetrahydroinden-1-one (PubChem CID 150262153) has the molecular formula C15H13BrO and a molecular weight of 289.17 g/mol. Its IUPAC name is 2-bromo-5-phenyl-2,3,3a,4-tetrahydroinden-1-one.
| Compound Name | 2-bromo-5-phenyl-2,3,3a,4-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 150262153 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-bromo-5-phenyl-2,3,3a,4-tetrahydroinden-1-one |
| SMILES | O=C1C2=CC=C(c3ccccc3)CC2CC1Br |
| InChI | InChI=1S/C15H13BrO/c16-14-9-12-8-11(6-7-13(12)15(14)17)10-4-2-1-3-5-10/h1-7,12,14H,8-9H2 |
| InChIKey | GBTWJPJUBZBDCO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|