C11H11BrO — CID 68625742
5-bromo-5,6,8,9-tetrahydrobenzo[7]annulen-7-one (PubChem CID 68625742) has the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. Its IUPAC name is 5-bromo-5,6,8,9-tetrahydrobenzo[7]annulen-7-one.
| Compound Name | 5-bromo-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 68625742 |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 5-bromo-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
| SMILES | O=C1CCc2ccccc2C(Br)C1 |
| InChI | InChI=1S/C11H11BrO/c12-11-7-9(13)6-5-8-3-1-2-4-10(8)11/h1-4,11H,5-7H2 |
| InChIKey | LPZRSPMPQFNEMH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|