C10H10Br2 — CID 3023387
1,3-dibromo-1,2,3,4-tetrahydronaphthalene (PubChem CID 3023387) has the molecular formula C10H10Br2 and a molecular weight of 290.00 g/mol. Its IUPAC name is 1,3-dibromo-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1,3-dibromo-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 3023387 |
| Molecular Formula | C10H10Br2 |
| Molecular Weight | 290.00 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 1,3-dibromo-1,2,3,4-tetrahydronaphthalene |
| SMILES | BrC1Cc2ccccc2C(Br)C1 |
| InChI | InChI=1S/C10H10Br2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-4,8,10H,5-6H2 |
| InChIKey | VUDWWNGBDAJKFX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.00 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|