C10H10Br2 — CID 45356914
(1R,4S)-1,4-dibromo-1,2,3,4-tetrahydronaphthalene (PubChem CID 45356914) has the molecular formula C10H10Br2 and a molecular weight of 290.00 g/mol. Its IUPAC name is (1R,4S)-1,4-dibromo-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,4S)-1,4-dibromo-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 45356914 |
| Molecular Formula | C10H10Br2 |
| Molecular Weight | 290.00 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | (1R,4S)-1,4-dibromo-1,2,3,4-tetrahydronaphthalene |
| SMILES | Br[C@@H]1CC[C@H](Br)c2ccccc21 |
| InChI | InChI=1S/C10H10Br2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-4,9-10H,5-6H2/t9-,10+ |
| InChIKey | ALQRYBAMWLAYNB-AOOOYVTPSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|