C11H13Br — CID 78952250
1-bromo-3-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 78952250) has the molecular formula C11H13Br and a molecular weight of 225.13 g/mol. Its IUPAC name is 1-bromo-3-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-3-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 78952250 |
| Molecular Formula | C11H13Br |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1-bromo-3-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1Cc2ccccc2C(Br)C1 |
| InChI | InChI=1S/C11H13Br/c1-8-6-9-4-2-3-5-10(9)11(12)7-8/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | GUNYIMCGTIXULK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|