About 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine
1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 174700533) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 174700533 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | COC1C(c2ccccc2)=CC=CC1(N)OC |
| InChI | InChI=1S/C14H17NO2/c1-16-13-12(11-7-4-3-5-8-11)9-6-10-14(13,15)17-2/h3-10,13H,15H2,1-2H3 |
| InChIKey | YGIAMIGZLGYAQC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine (CID 174700533) is 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine is COC1C(c2ccccc2)=CC=CC1(N)OC.
What is the InChIKey of 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine?
The InChIKey is YGIAMIGZLGYAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-16-13-12(11-7-4-3-5-8-11)9-6-10-14(13,15)17-2/h3-10,13H,15H2,1-2H3.
What are the key properties of 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine?
1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine has a molecular weight of 231.29 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethoxy-5-phenylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 174700533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).