C14H21NO3 — CID 11514339
(1R,2R)-2-(2-methoxyethoxymethoxy)-1-phenylbut-3-en-1-amine (PubChem CID 11514339) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (1R,2R)-2-(2-methoxyethoxymethoxy)-1-phenylbut-3-en-1-amine.
| Compound Name | (1R,2R)-2-(2-methoxyethoxymethoxy)-1-phenylbut-3-en-1-amine |
|---|---|
| PubChem CID | 11514339 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (1R,2R)-2-(2-methoxyethoxymethoxy)-1-phenylbut-3-en-1-amine |
| SMILES | C=C[C@@H](OCOCCOC)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-3-13(18-11-17-10-9-16-2)14(15)12-7-5-4-6-8-12/h3-8,13-14H,1,9-11,15H2,2H3/t13-,14-/m1/s1 |
| InChIKey | HGPXYSKTMLAVIT-ZIAGYGMSSA-N |
| XLogP | 1.88 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|