C11H17NO2 — CID 66940898
1,1-dimethoxy-3-phenylpropan-2-amine (PubChem CID 66940898) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1,1-dimethoxy-3-phenylpropan-2-amine.
| Compound Name | 1,1-dimethoxy-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 66940898 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1,1-dimethoxy-3-phenylpropan-2-amine |
| SMILES | COC(OC)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C11H17NO2/c1-13-11(14-2)10(12)8-9-6-4-3-5-7-9/h3-7,10-11H,8,12H2,1-2H3 |
| InChIKey | IFUOZMQFLICJQQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|