About 1,1'-biphenyl;ethynylphosphane
1,1'-biphenyl;ethynylphosphane (PubChem CID 159292728) has the molecular formula C14H13P
and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,1'-biphenyl;ethynylphosphane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;ethynylphosphane |
| PubChem CID | 159292728 |
| Molecular Formula | C14H13P |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1,1'-biphenyl;ethynylphosphane |
| SMILES | C#CP.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H3P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1-10H;1H,3H2 |
| InChIKey | LAIFTZVDNFHSIK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;ethynylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;ethynylphosphane?
The IUPAC name of 1,1'-biphenyl;ethynylphosphane (CID 159292728) is 1,1'-biphenyl;ethynylphosphane.
What is the SMILES notation for 1,1'-biphenyl;ethynylphosphane?
The canonical SMILES for 1,1'-biphenyl;ethynylphosphane is C#CP.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;ethynylphosphane?
The InChIKey is LAIFTZVDNFHSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H3P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1-10H;1H,3H2.
What are the key properties of 1,1'-biphenyl;ethynylphosphane?
1,1'-biphenyl;ethynylphosphane has a molecular weight of 212.23 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;ethynylphosphane is sourced from PubChem (CID 159292728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).