C24H25NO — CID 102307973
(1S,2R,6S,7R)-5-[4-(dimethylamino)phenyl]-4-phenyltricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 102307973) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-[4-(dimethylamino)phenyl]-4-phenyltricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1S,2R,6S,7R)-5-[4-(dimethylamino)phenyl]-4-phenyltricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 102307973 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (1S,2R,6S,7R)-5-[4-(dimethylamino)phenyl]-4-phenyltricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | CN(C)c1ccc(C2=C(c3ccccc3)C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@H]23)cc1 |
| InChI | InChI=1S/C24H25NO/c1-25(2)19-12-10-16(11-13-19)20-21-17-8-9-18(14-17)23(21)24(26)22(20)15-6-4-3-5-7-15/h3-7,10-13,17-18,21,23H,8-9,14H2,1-2H3/t17-,18+,21-,23-/m1/s1 |
| InChIKey | GKUDVXXFNXJAJD-NNTZPNAXSA-N |
| XLogP | 4.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|