C25H30N4O2 — CID 110558728
1-[4-(dimethylamino)phenyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-phenylpyrrole-2,5-dione (PubChem CID 110558728) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558728 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[methyl-(1-methylpiperidin-4-yl)amino]-4-phenylpyrrole-2,5-dione |
| SMILES | CN1CCC(N(C)C2=C(c3ccccc3)C(=O)N(c3ccc(N(C)C)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H30N4O2/c1-26(2)19-10-12-21(13-11-19)29-24(30)22(18-8-6-5-7-9-18)23(25(29)31)28(4)20-14-16-27(3)17-15-20/h5-13,20H,14-17H2,1-4H3 |
| InChIKey | DJUXACSTWZNKRA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|