C23H22F3N3O2 — CID 110545929
1-(3,4-difluorophenyl)-3-(4-fluorophenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 110545929) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(4-fluorophenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(4-fluorophenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110545929 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(4-fluorophenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | CN1CCC(N(C)C2=C(c3ccc(F)cc3)C(=O)N(c3ccc(F)c(F)c3)C2=O)CC1 |
| InChI | InChI=1S/C23H22F3N3O2/c1-27-11-9-16(10-12-27)28(2)21-20(14-3-5-15(24)6-4-14)22(30)29(23(21)31)17-7-8-18(25)19(26)13-17/h3-8,13,16H,9-12H2,1-2H3 |
| InChIKey | RALUGIQSMSTFMH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|