C17H15ClO — CID 129430789
(1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-4-chloro-6-phenyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane (PubChem CID 129430789) has the molecular formula C17H15ClO and a molecular weight of 270.76 g/mol. Its IUPAC name is (1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-4-chloro-6-phenyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane.
| Compound Name | (1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-4-chloro-6-phenyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
|---|---|
| PubChem CID | 129430789 |
| Molecular Formula | C17H15ClO |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (1S,2R,3R,4R,6S,7R,8S,9R,10S,12R)-4-chloro-6-phenyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
| SMILES | Cl[C@@]12O[C@@]3(c4ccccc4)[C@@H]4[C@H]5C[C@@H]([C@@H]6[C@@H]5[C@@H]3[C@H]61)[C@H]42 |
| InChI | InChI=1S/C17H15ClO/c18-17-13-9-6-8-10-11(9)15(17)14(10)16(19-17,12(8)13)7-4-2-1-3-5-7/h1-5,8-15H,6H2/t8-,9-,10+,11+,12+,13+,14+,15-,16-,17-/m0/s1 |
| InChIKey | NNRAZRDNYZMXTM-FRVNNECRSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|