C18H18O — CID 124724119
(1S,2R,3S,4S,6S,7R,8S,9R,10S,12R)-4-benzyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane (PubChem CID 124724119) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S,2R,3S,4S,6S,7R,8S,9R,10S,12R)-4-benzyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane.
| Compound Name | (1S,2R,3S,4S,6S,7R,8S,9R,10S,12R)-4-benzyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
|---|---|
| PubChem CID | 124724119 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (1S,2R,3S,4S,6S,7R,8S,9R,10S,12R)-4-benzyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
| SMILES | c1ccc(C[C@@]23O[C@@H]4[C@@H]5[C@@H]6[C@@H]7C[C@@H]([C@H]6[C@@H]52)[C@H]3[C@@H]74)cc1 |
| InChI | InChI=1S/C18H18O/c1-2-4-8(5-3-1)7-18-15-10-6-9-11-12(10)16(18)14(11)17(19-18)13(9)15/h1-5,9-17H,6-7H2/t9-,10-,11+,12+,13+,14+,15-,16-,17-,18-/m0/s1 |
| InChIKey | YBHLPFYTGOCVOD-YJCHWGAMSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |