C18H19NO2 — CID 10493090
(1R,2S,3S,5R,6R,7R,9S,10R,11R)-11-(benzylamino)-11-hydroxypentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one (PubChem CID 10493090) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is (1R,2S,3S,5R,6R,7R,9S,10R,11R)-11-(benzylamino)-11-hydroxypentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one.
| Compound Name | (1R,2S,3S,5R,6R,7R,9S,10R,11R)-11-(benzylamino)-11-hydroxypentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
|---|---|
| PubChem CID | 10493090 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (1R,2S,3S,5R,6R,7R,9S,10R,11R)-11-(benzylamino)-11-hydroxypentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
| SMILES | O=C1[C@@H]2[C@@H]3[C@H]4C[C@H]5[C@@H]3[C@H]2[C@@](O)(NCc2ccccc2)[C@H]5[C@@H]14 |
| InChI | InChI=1S/C18H19NO2/c20-17-13-9-6-10-12-11(9)14(17)16(12)18(21,15(10)13)19-7-8-4-2-1-3-5-8/h1-5,9-16,19,21H,6-7H2/t9-,10+,11-,12+,13+,14-,15-,16-,18-/m1/s1 |
| InChIKey | JAVPQBCHCMRWAB-XHOUGWFJSA-N |
| XLogP | 1.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|