C14H16O3 — CID 123758723
2-benzyl-2,6-dimethyloxane-3,4-dione (PubChem CID 123758723) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-benzyl-2,6-dimethyloxane-3,4-dione.
| Compound Name | 2-benzyl-2,6-dimethyloxane-3,4-dione |
|---|---|
| PubChem CID | 123758723 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-benzyl-2,6-dimethyloxane-3,4-dione |
| SMILES | CC1CC(=O)C(=O)C(C)(Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H16O3/c1-10-8-12(15)13(16)14(2,17-10)9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | XINPLQCPOJQEKV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|