C36H39N3O9 — CID 102513519
3,9,15-tribenzyl-3,9,15-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 102513519) has the molecular formula C36H39N3O9 and a molecular weight of 657.72 g/mol. Its IUPAC name is 3,9,15-tribenzyl-3,9,15-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 3,9,15-tribenzyl-3,9,15-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 102513519 |
| Molecular Formula | C36H39N3O9 |
| Molecular Weight | 657.72 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | 3,9,15-tribenzyl-3,9,15-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC1(Cc2ccccc2)NC(=O)COC(=O)C(C)(Cc2ccccc2)NC(=O)COC(=O)C(C)(Cc2ccccc2)NC(=O)COC1=O |
| InChI | InChI=1S/C36H39N3O9/c1-34(19-25-13-7-4-8-14-25)31(43)46-23-29(41)38-36(3,21-27-17-11-6-12-18-27)33(45)48-24-30(42)39-35(2,20-26-15-9-5-10-16-26)32(44)47-22-28(40)37-34/h4-18H,19-24H2,1-3H3,(H,37,40)(H,38,41)(H,39,42) |
| InChIKey | QZIPKXZCVPBQPL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 166.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|