C11H13NO3 — CID 102580214
(4S)-4-benzyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 102580214) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (4S)-4-benzyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102580214 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (4S)-4-benzyl-4-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@](CO)(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C11H13NO3/c13-7-11(8-15-10(14)12-11)6-9-4-2-1-3-5-9/h1-5,13H,6-8H2,(H,12,14)/t11-/m0/s1 |
| InChIKey | FZRGBQHHOFSILY-NSHDSACASA-N |
| XLogP | 0.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |