C20H23NO3 — CID 22618845
4-ethyl-4-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 22618845) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-ethyl-4-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-ethyl-4-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22618845 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-ethyl-4-[2-(4-phenylmethoxyphenyl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | CCC1(CCc2ccc(OCc3ccccc3)cc2)COC(=O)N1 |
| InChI | InChI=1S/C20H23NO3/c1-2-20(15-24-19(22)21-20)13-12-16-8-10-18(11-9-16)23-14-17-6-4-3-5-7-17/h3-11H,2,12-15H2,1H3,(H,21,22) |
| InChIKey | MVBWXEOVQOJYHF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |