C28H38NO6P — CID 11156566
(4S)-4-[2-(4-octylphenyl)ethyl]-4-[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxymethyl]-1,3-oxazolidin-2-one (PubChem CID 11156566) has the molecular formula C28H38NO6P and a molecular weight of 515.59 g/mol. Its IUPAC name is (4S)-4-[2-(4-octylphenyl)ethyl]-4-[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxymethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[2-(4-octylphenyl)ethyl]-4-[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxymethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11156566 |
| Molecular Formula | C28H38NO6P |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (4S)-4-[2-(4-octylphenyl)ethyl]-4-[(3-oxo-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepin-3-yl)oxymethyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCc1ccc(CC[C@@]2(COP3(=O)OCc4ccccc4CO3)COC(=O)N2)cc1 |
| InChI | InChI=1S/C28H38NO6P/c1-2-3-4-5-6-7-10-23-13-15-24(16-14-23)17-18-28(21-32-27(30)29-28)22-35-36(31)33-19-25-11-8-9-12-26(25)20-34-36/h8-9,11-16H,2-7,10,17-22H2,1H3,(H,29,30)/t28-/m0/s1 |
| InChIKey | PNWRXMYOUVUBLV-NDEPHWFRSA-N |
| XLogP | 6.87 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|