C21H33NO3 — CID 22618854
4-methyl-4-[2-(4-nonoxyphenyl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 22618854) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is 4-methyl-4-[2-(4-nonoxyphenyl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-methyl-4-[2-(4-nonoxyphenyl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22618854 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 4-methyl-4-[2-(4-nonoxyphenyl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCOc1ccc(CCC2(C)COC(=O)N2)cc1 |
| InChI | InChI=1S/C21H33NO3/c1-3-4-5-6-7-8-9-16-24-19-12-10-18(11-13-19)14-15-21(2)17-25-20(23)22-21/h10-13H,3-9,14-17H2,1-2H3,(H,22,23) |
| InChIKey | WGYJAGFWCFLMFV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|