C20H34NO5P — CID 11567503
5-[4-(4-heptoxyphenyl)butyl]-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-amine (PubChem CID 11567503) has the molecular formula C20H34NO5P and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-[4-(4-heptoxyphenyl)butyl]-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-amine.
| Compound Name | 5-[4-(4-heptoxyphenyl)butyl]-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-amine |
|---|---|
| PubChem CID | 11567503 |
| Molecular Formula | C20H34NO5P |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 5-[4-(4-heptoxyphenyl)butyl]-2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-5-amine |
| SMILES | CCCCCCCOc1ccc(CCCCC2(N)COP(=O)(O)OC2)cc1 |
| InChI | InChI=1S/C20H34NO5P/c1-2-3-4-5-8-15-24-19-12-10-18(11-13-19)9-6-7-14-20(21)16-25-27(22,23)26-17-20/h10-13H,2-9,14-17,21H2,1H3,(H,22,23) |
| InChIKey | ZRXHCOWQMWSIQX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|