C20H28F6NO9P — CID 87965636
2-hydroxy-2-oxo-5-[2-(4-pentoxyphenyl)ethyl]-1,3,2λ5-dioxaphosphinan-5-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87965636) has the molecular formula C20H28F6NO9P and a molecular weight of 571.40 g/mol. Its IUPAC name is 2-hydroxy-2-oxo-5-[2-(4-pentoxyphenyl)ethyl]-1,3,2λ5-dioxaphosphinan-5-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-hydroxy-2-oxo-5-[2-(4-pentoxyphenyl)ethyl]-1,3,2λ5-dioxaphosphinan-5-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87965636 |
| Molecular Formula | C20H28F6NO9P |
| Molecular Weight | 571.40 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 2-hydroxy-2-oxo-5-[2-(4-pentoxyphenyl)ethyl]-1,3,2λ5-dioxaphosphinan-5-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCCCOc1ccc(CCC2(N)COP(=O)(O)OC2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26NO5P.2C2HF3O2/c1-2-3-4-11-20-15-7-5-14(6-8-15)9-10-16(17)12-21-23(18,19)22-13-16;2*3-2(4,5)1(6)7/h5-8H,2-4,9-13,17H2,1H3,(H,18,19);2*(H,6,7) |
| InChIKey | PKFNFRVNITWWOG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|