C19H31O6P — CID 172845612
4-hexyl-2-hydroxy-4-(5-phenoxypentoxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 172845612) has the molecular formula C19H31O6P and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-hexyl-2-hydroxy-4-(5-phenoxypentoxy)-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 4-hexyl-2-hydroxy-4-(5-phenoxypentoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 172845612 |
| Molecular Formula | C19H31O6P |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-hexyl-2-hydroxy-4-(5-phenoxypentoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CCCCCCC1(OCCCCCOc2ccccc2)COP(=O)(O)O1 |
| InChI | InChI=1S/C19H31O6P/c1-2-3-4-9-14-19(17-24-26(20,21)25-19)23-16-11-6-10-15-22-18-12-7-5-8-13-18/h5,7-8,12-13H,2-4,6,9-11,14-17H2,1H3,(H,20,21) |
| InChIKey | XJKSTGNEKNSLMO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|