C15H23O3P — CID 11129748
(2S)-2-octyl-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide (PubChem CID 11129748) has the molecular formula C15H23O3P and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S)-2-octyl-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide.
| Compound Name | (2S)-2-octyl-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 11129748 |
| Molecular Formula | C15H23O3P |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2S)-2-octyl-4H-1,3,2λ5-benzodioxaphosphinine 2-oxide |
| SMILES | CCCCCCCC[P@]1(=O)OCc2ccccc2O1 |
| InChI | InChI=1S/C15H23O3P/c1-2-3-4-5-6-9-12-19(16)17-13-14-10-7-8-11-15(14)18-19/h7-8,10-11H,2-6,9,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | YTURVHUJFLMJCA-IBGZPJMESA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|