C14H22BrN — CID 44660920
2-hexyl-2,3-dihydro-1H-isoindol-2-ium bromide (PubChem CID 44660920) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-hexyl-2,3-dihydro-1H-isoindol-2-ium bromide.
| Compound Name | 2-hexyl-2,3-dihydro-1H-isoindol-2-ium bromide |
|---|---|
| PubChem CID | 44660920 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-hexyl-2,3-dihydro-1H-isoindol-2-ium bromide |
| SMILES | CCCCCC[NH+]1Cc2ccccc2C1.[Br-] |
| InChI | InChI=1S/C14H21N.BrH/c1-2-3-4-7-10-15-11-13-8-5-6-9-14(13)12-15;/h5-6,8-9H,2-4,7,10-12H2,1H3;1H |
| InChIKey | SCFVAEQHZSNIAI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|