C8H10NO2PS — CID 24834923
N-methyl-2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-amine (PubChem CID 24834923) has the molecular formula C8H10NO2PS and a molecular weight of 215.21 g/mol. Its IUPAC name is N-methyl-2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-amine.
| Compound Name | N-methyl-2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-amine |
|---|---|
| PubChem CID | 24834923 |
| Molecular Formula | C8H10NO2PS |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | N-methyl-2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-amine |
| SMILES | CNP1(=S)OCc2ccccc2O1 |
| InChI | InChI=1S/C8H10NO2PS/c1-9-12(13)10-6-7-4-2-3-5-8(7)11-12/h2-5H,6H2,1H3,(H,9,13) |
| InChIKey | ADQHQMMZKBOJMZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|