3-octyl-2,4-dihydrochromene-3-carboxylic acid

C18H26O3 — CID 65406790

IUPAC3-octyl-2,4-dihydrochromene-3-carboxylic acid
SMILESCCCCCCCCC1(C(=O)O)COc2ccccc2C1
InChIInChI=1S/C18H26O3/c1-2-3-4-5-6-9-12-18(17(19)20)13-15-10-7-8-11-16(15)21-14-18/h7-8,10-11H,2-6,9,12-14H2,1H3,(H,19,20)
InChIKeySXQXDGKSSODSDB-UHFFFAOYSA-N
MW290.40 g/mol
LogP4.44
Rot. Bonds8

About 3-octyl-2,4-dihydrochromene-3-carboxylic acid

3-octyl-2,4-dihydrochromene-3-carboxylic acid (PubChem CID 65406790) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 3-octyl-2,4-dihydrochromene-3-carboxylic acid.

Molecular Properties

Compound Name3-octyl-2,4-dihydrochromene-3-carboxylic acid
PubChem CID65406790
Molecular FormulaC18H26O3
Molecular Weight290.40 g/mol
Exact Mass290.19
IUPAC Name3-octyl-2,4-dihydrochromene-3-carboxylic acid
SMILESCCCCCCCCC1(C(=O)O)COc2ccccc2C1
InChIInChI=1S/C18H26O3/c1-2-3-4-5-6-9-12-18(17(19)20)13-15-10-7-8-11-16(15)21-14-18/h7-8,10-11H,2-6,9,12-14H2,1H3,(H,19,20)
InChIKeySXQXDGKSSODSDB-UHFFFAOYSA-N
XLogP4.44
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.40
LogP ≤ 54.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-octyl-2,4-dihydrochromene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-octyl-2,4-dihydrochromene-3-carboxylic acid?
The IUPAC name of 3-octyl-2,4-dihydrochromene-3-carboxylic acid (CID 65406790) is 3-octyl-2,4-dihydrochromene-3-carboxylic acid.
What is the SMILES notation for 3-octyl-2,4-dihydrochromene-3-carboxylic acid?
The canonical SMILES for 3-octyl-2,4-dihydrochromene-3-carboxylic acid is CCCCCCCCC1(C(=O)O)COc2ccccc2C1.
What is the InChIKey of 3-octyl-2,4-dihydrochromene-3-carboxylic acid?
The InChIKey is SXQXDGKSSODSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c1-2-3-4-5-6-9-12-18(17(19)20)13-15-10-7-8-11-16(15)21-14-18/h7-8,10-11H,2-6,9,12-14H2,1H3,(H,19,20).
What are the key properties of 3-octyl-2,4-dihydrochromene-3-carboxylic acid?
3-octyl-2,4-dihydrochromene-3-carboxylic acid has a molecular weight of 290.40 g/mol, XLogP of 4.44, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octyl-2,4-dihydrochromene-3-carboxylic acid is sourced from PubChem (CID 65406790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).