C25H44NO5P — CID 143009519
diethyl [(4R)-2-methyl-4-[2-(4-octylphenyl)ethyl]-1,3-oxazolidin-4-yl]methyl phosphate (PubChem CID 143009519) has the molecular formula C25H44NO5P and a molecular weight of 469.60 g/mol. Its IUPAC name is diethyl [(4R)-2-methyl-4-[2-(4-octylphenyl)ethyl]-1,3-oxazolidin-4-yl]methyl phosphate.
| Compound Name | diethyl [(4R)-2-methyl-4-[2-(4-octylphenyl)ethyl]-1,3-oxazolidin-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 143009519 |
| Molecular Formula | C25H44NO5P |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | diethyl [(4R)-2-methyl-4-[2-(4-octylphenyl)ethyl]-1,3-oxazolidin-4-yl]methyl phosphate |
| SMILES | CCCCCCCCc1ccc(CC[C@]2(COP(=O)(OCC)OCC)COC(C)N2)cc1 |
| InChI | InChI=1S/C25H44NO5P/c1-5-8-9-10-11-12-13-23-14-16-24(17-15-23)18-19-25(20-28-22(4)26-25)21-31-32(27,29-6-2)30-7-3/h14-17,22,26H,5-13,18-21H2,1-4H3/t22?,25-/m1/s1 |
| InChIKey | MGYUDSGLZICVBL-NRWPOFLRSA-N |
| XLogP | 6.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|