C32H53O4P — CID 58757831
ethyl (4-nonylcyclohexa-1,3-dien-1-yl) (4-nonylphenyl) phosphate (PubChem CID 58757831) has the molecular formula C32H53O4P and a molecular weight of 532.75 g/mol. Its IUPAC name is ethyl (4-nonylcyclohexa-1,3-dien-1-yl) (4-nonylphenyl) phosphate.
| Compound Name | ethyl (4-nonylcyclohexa-1,3-dien-1-yl) (4-nonylphenyl) phosphate |
|---|---|
| PubChem CID | 58757831 |
| Molecular Formula | C32H53O4P |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | ethyl (4-nonylcyclohexa-1,3-dien-1-yl) (4-nonylphenyl) phosphate |
| SMILES | CCCCCCCCCC1=CC=C(OP(=O)(OCC)Oc2ccc(CCCCCCCCC)cc2)CC1 |
| InChI | InChI=1S/C32H53O4P/c1-4-7-9-11-13-15-17-19-29-21-25-31(26-22-29)35-37(33,34-6-3)36-32-27-23-30(24-28-32)20-18-16-14-12-10-8-5-2/h21-23,25-27H,4-20,24,28H2,1-3H3 |
| InChIKey | NTPODGHEQISIEH-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|