About (4-nonylphenyl)phosphane;phosphane
(4-nonylphenyl)phosphane;phosphane (PubChem CID 174846018) has the molecular formula C15H28P2
and a molecular weight of 270.34 g/mol. Its IUPAC name is (4-nonylphenyl)phosphane;phosphane.
Molecular Properties
| Compound Name | (4-nonylphenyl)phosphane;phosphane |
| PubChem CID | 174846018 |
| Molecular Formula | C15H28P2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (4-nonylphenyl)phosphane;phosphane |
| SMILES | CCCCCCCCCc1ccc(P)cc1.P |
| InChI | InChI=1S/C15H25P.H3P/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;/h10-13H,2-9,16H2,1H3;1H3 |
| InChIKey | XOFYNDPDDLQDGD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-nonylphenyl)phosphane;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nonylphenyl)phosphane;phosphane?
The IUPAC name of (4-nonylphenyl)phosphane;phosphane (CID 174846018) is (4-nonylphenyl)phosphane;phosphane.
What is the SMILES notation for (4-nonylphenyl)phosphane;phosphane?
The canonical SMILES for (4-nonylphenyl)phosphane;phosphane is CCCCCCCCCc1ccc(P)cc1.P.
What is the InChIKey of (4-nonylphenyl)phosphane;phosphane?
The InChIKey is XOFYNDPDDLQDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25P.H3P/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14;/h10-13H,2-9,16H2,1H3;1H3.
What are the key properties of (4-nonylphenyl)phosphane;phosphane?
(4-nonylphenyl)phosphane;phosphane has a molecular weight of 270.34 g/mol, XLogP of 4.54, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nonylphenyl)phosphane;phosphane is sourced from PubChem (CID 174846018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).