C17H17NOS — CID 25214828
4,4-dibenzyl-1,3-oxazolidine-2-thione (PubChem CID 25214828) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 4,4-dibenzyl-1,3-oxazolidine-2-thione.
| Compound Name | 4,4-dibenzyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 25214828 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4,4-dibenzyl-1,3-oxazolidine-2-thione |
| SMILES | S=C1NC(Cc2ccccc2)(Cc2ccccc2)CO1 |
| InChI | InChI=1S/C17H17NOS/c20-16-18-17(13-19-16,11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,18,20) |
| InChIKey | NKUDHGWILWFMGO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|