C30H30O2P+ — CID 86746663
2-(2-benzyl-1,3-dioxolan-2-yl)ethyl-triphenylphosphanium (PubChem CID 86746663) has the molecular formula C30H30O2P+ and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-dioxolan-2-yl)ethyl-triphenylphosphanium.
| Compound Name | 2-(2-benzyl-1,3-dioxolan-2-yl)ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 86746663 |
| Molecular Formula | C30H30O2P+ |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-(2-benzyl-1,3-dioxolan-2-yl)ethyl-triphenylphosphanium |
| SMILES | c1ccc(CC2(CC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)OCCO2)cc1 |
| InChI | InChI=1S/C30H30O2P/c1-5-13-26(14-6-1)25-30(31-22-23-32-30)21-24-33(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20H,21-25H2/q+1 |
| InChIKey | BAIIWTRYXUOTMH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|