C16H20N2O2 — CID 20547993
1-[2-(2-benzyl-1,3-dioxan-2-yl)ethyl]imidazole (PubChem CID 20547993) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-[2-(2-benzyl-1,3-dioxan-2-yl)ethyl]imidazole.
| Compound Name | 1-[2-(2-benzyl-1,3-dioxan-2-yl)ethyl]imidazole |
|---|---|
| PubChem CID | 20547993 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[2-(2-benzyl-1,3-dioxan-2-yl)ethyl]imidazole |
| SMILES | c1ccc(CC2(CCn3ccnc3)OCCCO2)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-5-15(6-3-1)13-16(19-11-4-12-20-16)7-9-18-10-8-17-14-18/h1-3,5-6,8,10,14H,4,7,9,11-13H2 |
| InChIKey | UETOCUHTMOSBJW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |