C17H22N2O2 — CID 20547713
1-[[2-[2-(3-methylphenyl)ethyl]-1,3-dioxan-2-yl]methyl]imidazole (PubChem CID 20547713) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-[[2-[2-(3-methylphenyl)ethyl]-1,3-dioxan-2-yl]methyl]imidazole.
| Compound Name | 1-[[2-[2-(3-methylphenyl)ethyl]-1,3-dioxan-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 20547713 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[[2-[2-(3-methylphenyl)ethyl]-1,3-dioxan-2-yl]methyl]imidazole |
| SMILES | Cc1cccc(CCC2(Cn3ccnc3)OCCCO2)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-15-4-2-5-16(12-15)6-7-17(20-10-3-11-21-17)13-19-9-8-18-14-19/h2,4-5,8-9,12,14H,3,6-7,10-11,13H2,1H3 |
| InChIKey | AVBYAXCPRJKEMO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |