C14H17BrN2O2 — CID 20547508
1-[(2-benzyl-1,3-dioxolan-2-yl)methyl]imidazole;hydrobromide (PubChem CID 20547508) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-[(2-benzyl-1,3-dioxolan-2-yl)methyl]imidazole;hydrobromide.
| Compound Name | 1-[(2-benzyl-1,3-dioxolan-2-yl)methyl]imidazole;hydrobromide |
|---|---|
| PubChem CID | 20547508 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-[(2-benzyl-1,3-dioxolan-2-yl)methyl]imidazole;hydrobromide |
| SMILES | Br.c1ccc(CC2(Cn3ccnc3)OCCO2)cc1 |
| InChI | InChI=1S/C14H16N2O2.BrH/c1-2-4-13(5-3-1)10-14(17-8-9-18-14)11-16-7-6-15-12-16;/h1-7,12H,8-11H2;1H |
| InChIKey | LDIDYEFXVNNBJB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |